C18H17N3O3 — CID 51266037
4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-pyridin-2-ylbutanamide (PubChem CID 51266037) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-pyridin-2-ylbutanamide.
| Compound Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 51266037 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-pyridin-2-ylbutanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)Nc1ccccn1)C2=O |
| InChI | InChI=1S/C18H17N3O3/c1-12-7-8-13-14(11-12)18(24)21(17(13)23)10-4-6-16(22)20-15-5-2-3-9-19-15/h2-3,5,7-9,11H,4,6,10H2,1H3,(H,19,20,22) |
| InChIKey | XGGYOCZDFNMNDH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|