C27H26N2O3 — CID 27770580
N-(2,2-diphenylethyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 27770580) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-(2,2-diphenylethyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 27770580 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N-(2,2-diphenylethyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)NCC(c1ccccc1)c1ccccc1)C2=O |
| InChI | InChI=1S/C27H26N2O3/c1-19-14-15-22-23(17-19)27(32)29(26(22)31)16-8-13-25(30)28-18-24(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-12,14-15,17,24H,8,13,16,18H2,1H3,(H,28,30) |
| InChIKey | HDHQGFRSRGXKDJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|