C16H20N2O4S — CID 97006967
3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2S)-2-[(S)-methylsulfinyl]propyl]propanamide (PubChem CID 97006967) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2S)-2-[(S)-methylsulfinyl]propyl]propanamide.
| Compound Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2S)-2-[(S)-methylsulfinyl]propyl]propanamide |
|---|---|
| PubChem CID | 97006967 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2S)-2-[(S)-methylsulfinyl]propyl]propanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)NC[C@H](C)[S@](C)=O)C2=O |
| InChI | InChI=1S/C16H20N2O4S/c1-10-4-5-12-13(8-10)16(21)18(15(12)20)7-6-14(19)17-9-11(2)23(3)22/h4-5,8,11H,6-7,9H2,1-3H3,(H,17,19)/t11-,23-/m0/s1 |
| InChIKey | GTJVPSLDQWOJHA-RULNZOCKSA-N |
| XLogP | 0.86 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|