C18H18N2O5 — CID 78866341
N-[2-(furan-2-yl)-2-hydroxyethyl]-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 78866341) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxyethyl]-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxyethyl]-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 78866341 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxyethyl]-3-(5-methyl-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)NCC(O)c1ccco1)C2=O |
| InChI | InChI=1S/C18H18N2O5/c1-11-4-5-12-13(9-11)18(24)20(17(12)23)7-6-16(22)19-10-14(21)15-3-2-8-25-15/h2-5,8-9,14,21H,6-7,10H2,1H3,(H,19,22) |
| InChIKey | ZTULGYKOPJVZHR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|