C23H27N3O3 — CID 51265030
N-[2-(dimethylamino)-2-phenylethyl]-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 51265030) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 51265030 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)NCC(c1ccccc1)N(C)C)C2=O |
| InChI | InChI=1S/C23H27N3O3/c1-16-11-12-18-19(14-16)23(29)26(22(18)28)13-7-10-21(27)24-15-20(25(2)3)17-8-5-4-6-9-17/h4-6,8-9,11-12,14,20H,7,10,13,15H2,1-3H3,(H,24,27) |
| InChIKey | XSCZJTOKZUXIPZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|