C22H24N2O3S — CID 46475036
4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[2-(4-methylphenyl)sulfanylethyl]butanamide (PubChem CID 46475036) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[2-(4-methylphenyl)sulfanylethyl]butanamide.
| Compound Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[2-(4-methylphenyl)sulfanylethyl]butanamide |
|---|---|
| PubChem CID | 46475036 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[2-(4-methylphenyl)sulfanylethyl]butanamide |
| SMILES | Cc1ccc(SCCNC(=O)CCCN2C(=O)c3ccc(C)cc3C2=O)cc1 |
| InChI | InChI=1S/C22H24N2O3S/c1-15-5-8-17(9-6-15)28-13-11-23-20(25)4-3-12-24-21(26)18-10-7-16(2)14-19(18)22(24)27/h5-10,14H,3-4,11-13H2,1-2H3,(H,23,25) |
| InChIKey | ZQKZJONWPMBOBT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|