C27H29N3O4 — CID 42987393
N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide (PubChem CID 42987393) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide |
|---|---|
| PubChem CID | 42987393 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide |
| SMILES | COc1ccc(C(CNC(=O)CCCN2C(=O)c3cccc4cccc(c34)C2=O)N(C)C)cc1 |
| InChI | InChI=1S/C27H29N3O4/c1-29(2)23(18-12-14-20(34-3)15-13-18)17-28-24(31)11-6-16-30-26(32)21-9-4-7-19-8-5-10-22(25(19)21)27(30)33/h4-5,7-10,12-15,23H,6,11,16-17H2,1-3H3,(H,28,31) |
| InChIKey | XLYPOBKADUPPCG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|