C18H18N2O4 — CID 2922128
4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-hydroxyethyl)butanamide (PubChem CID 2922128) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-hydroxyethyl)butanamide.
| Compound Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-hydroxyethyl)butanamide |
|---|---|
| PubChem CID | 2922128 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-hydroxyethyl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)NCCO |
| InChI | InChI=1S/C18H18N2O4/c21-11-9-19-15(22)8-3-10-20-17(23)13-6-1-4-12-5-2-7-14(16(12)13)18(20)24/h1-2,4-7,21H,3,8-11H2,(H,19,22) |
| InChIKey | AJLZHZHZYCTKJG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|