C22H20N2O3S — CID 27770177
4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-thiophen-2-ylethyl)butanamide (PubChem CID 27770177) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-thiophen-2-ylethyl)butanamide.
| Compound Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-thiophen-2-ylethyl)butanamide |
|---|---|
| PubChem CID | 27770177 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-thiophen-2-ylethyl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)NCCc1cccs1 |
| InChI | InChI=1S/C22H20N2O3S/c25-19(23-12-11-16-7-4-14-28-16)10-3-13-24-21(26)17-8-1-5-15-6-2-9-18(20(15)17)22(24)27/h1-2,4-9,14H,3,10-13H2,(H,23,25) |
| InChIKey | HVILQAIFYQRJMZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|