C24H22N2O5S — CID 55734054
N-[2-(benzenesulfonyl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide (PubChem CID 55734054) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide.
| Compound Name | N-[2-(benzenesulfonyl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide |
|---|---|
| PubChem CID | 55734054 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethyl]-4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O5S/c27-21(25-14-16-32(30,31)18-9-2-1-3-10-18)13-6-15-26-23(28)19-11-4-7-17-8-5-12-20(22(17)19)24(26)29/h1-5,7-12H,6,13-16H2,(H,25,27) |
| InChIKey | VKMRBOFUMQFJJR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|