C17H16N2O4 — CID 86981058
N-[2-(furan-2-yl)-2-hydroxyethyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide (PubChem CID 86981058) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxyethyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxyethyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 86981058 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxyethyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide |
| SMILES | C=C1c2ccccc2C(=O)N1CC(=O)NCC(O)c1ccco1 |
| InChI | InChI=1S/C17H16N2O4/c1-11-12-5-2-3-6-13(12)17(22)19(11)10-16(21)18-9-14(20)15-7-4-8-23-15/h2-8,14,20H,1,9-10H2,(H,18,21) |
| InChIKey | FOVFEGWZDIKVQY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |