C20H16N2O5S — CID 121133461
2-(1,3-dioxoisoindol-2-yl)-N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]acetamide (PubChem CID 121133461) has the molecular formula C20H16N2O5S and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 121133461 |
| Molecular Formula | C20H16N2O5S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NCc1ccc(C(O)c2ccco2)s1 |
| InChI | InChI=1S/C20H16N2O5S/c23-17(11-22-19(25)13-4-1-2-5-14(13)20(22)26)21-10-12-7-8-16(28-12)18(24)15-6-3-9-27-15/h1-9,18,24H,10-11H2,(H,21,23) |
| InChIKey | PBEFTNNLPFKSOQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|