C19H18N2O4S — CID 121133602
N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]-N'-(2-methylphenyl)oxamide (PubChem CID 121133602) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]-N'-(2-methylphenyl)oxamide.
| Compound Name | N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]-N'-(2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 121133602 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]-N'-(2-methylphenyl)oxamide |
| SMILES | Cc1ccccc1NC(=O)C(=O)NCc1ccc(C(O)c2ccco2)s1 |
| InChI | InChI=1S/C19H18N2O4S/c1-12-5-2-3-6-14(12)21-19(24)18(23)20-11-13-8-9-16(26-13)17(22)15-7-4-10-25-15/h2-10,17,22H,11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | HGPCCWNEEAGSBO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|