C21H23NO3S — CID 99873348
4-tert-butyl-N-[[5-[(R)-furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]benzamide (PubChem CID 99873348) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 4-tert-butyl-N-[[5-[(R)-furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[5-[(R)-furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 99873348 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-tert-butyl-N-[[5-[(R)-furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCc2ccc([C@H](O)c3ccco3)s2)cc1 |
| InChI | InChI=1S/C21H23NO3S/c1-21(2,3)15-8-6-14(7-9-15)20(24)22-13-16-10-11-18(26-16)19(23)17-5-4-12-25-17/h4-12,19,23H,13H2,1-3H3,(H,22,24)/t19-/m1/s1 |
| InChIKey | ILGBRRWZQFXLCG-LJQANCHMSA-N |
| XLogP | 4.65 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |