C17H14ClNO2S2 — CID 97041440
4-chloro-N-[[5-[(S)-hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]benzamide (PubChem CID 97041440) has the molecular formula C17H14ClNO2S2 and a molecular weight of 363.89 g/mol. Its IUPAC name is 4-chloro-N-[[5-[(S)-hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[5-[(S)-hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 97041440 |
| Molecular Formula | C17H14ClNO2S2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 4-chloro-N-[[5-[(S)-hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1ccc([C@@H](O)c2cccs2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClNO2S2/c18-12-5-3-11(4-6-12)17(21)19-10-13-7-8-15(23-13)16(20)14-2-1-9-22-14/h1-9,16,20H,10H2,(H,19,21)/t16-/m0/s1 |
| InChIKey | SXLNXAUZKMAXJT-INIZCTEOSA-N |
| XLogP | 4.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |