C24H21NO2S2 — CID 90583549
N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-2-(4-phenylphenyl)acetamide (PubChem CID 90583549) has the molecular formula C24H21NO2S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 90583549 |
| Molecular Formula | C24H21NO2S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-2-(4-phenylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)NCc1ccc(C(O)c2cccs2)s1 |
| InChI | InChI=1S/C24H21NO2S2/c26-23(15-17-8-10-19(11-9-17)18-5-2-1-3-6-18)25-16-20-12-13-22(29-20)24(27)21-7-4-14-28-21/h1-14,24,27H,15-16H2,(H,25,26) |
| InChIKey | MZXMYKUAGNYLPA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |