C26H23NO2S — CID 121134188
N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-(4-phenylphenyl)acetamide (PubChem CID 121134188) has the molecular formula C26H23NO2S and a molecular weight of 413.54 g/mol. Its IUPAC name is N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 121134188 |
| Molecular Formula | C26H23NO2S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-(4-phenylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)NCc1ccc(C(O)c2ccccc2)s1 |
| InChI | InChI=1S/C26H23NO2S/c28-25(17-19-11-13-21(14-12-19)20-7-3-1-4-8-20)27-18-23-15-16-24(30-23)26(29)22-9-5-2-6-10-22/h1-16,26,29H,17-18H2,(H,27,28) |
| InChIKey | RMCVOHLLJVSIOD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |