C23H19NO2S — CID 121134132
N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]naphthalene-1-carboxamide (PubChem CID 121134132) has the molecular formula C23H19NO2S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]naphthalene-1-carboxamide.
| Compound Name | N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 121134132 |
| Molecular Formula | C23H19NO2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]naphthalene-1-carboxamide |
| SMILES | O=C(NCc1ccc(C(O)c2ccccc2)s1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H19NO2S/c25-22(17-8-2-1-3-9-17)21-14-13-18(27-21)15-24-23(26)20-12-6-10-16-7-4-5-11-19(16)20/h1-14,22,25H,15H2,(H,24,26) |
| InChIKey | HNOGLMZJVJGHIM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |