C20H18ClNO3S — CID 121134157
5-chloro-N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-methoxybenzamide (PubChem CID 121134157) has the molecular formula C20H18ClNO3S and a molecular weight of 387.89 g/mol. Its IUPAC name is 5-chloro-N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 121134157 |
| Molecular Formula | C20H18ClNO3S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 5-chloro-N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCc1ccc(C(O)c2ccccc2)s1 |
| InChI | InChI=1S/C20H18ClNO3S/c1-25-17-9-7-14(21)11-16(17)20(24)22-12-15-8-10-18(26-15)19(23)13-5-3-2-4-6-13/h2-11,19,23H,12H2,1H3,(H,22,24) |
| InChIKey | LOZRAEICJGHEPQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |