C22H19NO2S2 — CID 90583516
N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-2-naphthalen-1-ylacetamide (PubChem CID 90583516) has the molecular formula C22H19NO2S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 90583516 |
| Molecular Formula | C22H19NO2S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-[[5-[hydroxy(thiophen-2-yl)methyl]thiophen-2-yl]methyl]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)NCc1ccc(C(O)c2cccs2)s1 |
| InChI | InChI=1S/C22H19NO2S2/c24-21(13-16-7-3-6-15-5-1-2-8-18(15)16)23-14-17-10-11-20(27-17)22(25)19-9-4-12-26-19/h1-12,22,25H,13-14H2,(H,23,24) |
| InChIKey | QTAJAEXIXZYLHT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |