C17H18N2O3S — CID 121134301
N'-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-N-prop-2-enyloxamide (PubChem CID 121134301) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is N'-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-N-prop-2-enyloxamide.
| Compound Name | N'-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 121134301 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N'-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCc1ccc(C(O)c2ccccc2)s1 |
| InChI | InChI=1S/C17H18N2O3S/c1-2-10-18-16(21)17(22)19-11-13-8-9-14(23-13)15(20)12-6-4-3-5-7-12/h2-9,15,20H,1,10-11H2,(H,18,21)(H,19,22) |
| InChIKey | LKWRIMPSAVHAJW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|