C20H20N2O3S2 — CID 121133968
N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-N'-(1-phenylethyl)oxamide (PubChem CID 121133968) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-N'-(1-phenylethyl)oxamide.
| Compound Name | N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-N'-(1-phenylethyl)oxamide |
|---|---|
| PubChem CID | 121133968 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-N'-(1-phenylethyl)oxamide |
| SMILES | CC(NC(=O)C(=O)NCc1ccc(C(O)c2ccsc2)s1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O3S2/c1-13(14-5-3-2-4-6-14)22-20(25)19(24)21-11-16-7-8-17(27-16)18(23)15-9-10-26-12-15/h2-10,12-13,18,23H,11H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | VIIFGPFHSNFTGM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|