C18H16ClNO2S2 — CID 121133766
2-(2-chlorophenyl)-N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]acetamide (PubChem CID 121133766) has the molecular formula C18H16ClNO2S2 and a molecular weight of 377.92 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 121133766 |
| Molecular Formula | C18H16ClNO2S2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]acetamide |
| SMILES | O=C(Cc1ccccc1Cl)NCc1ccc(C(O)c2ccsc2)s1 |
| InChI | InChI=1S/C18H16ClNO2S2/c19-15-4-2-1-3-12(15)9-17(21)20-10-14-5-6-16(24-14)18(22)13-7-8-23-11-13/h1-8,11,18,22H,9-10H2,(H,20,21) |
| InChIKey | OSXMOUDPUIPUMH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |