C20H20N2O4S2 — CID 121133990
N'-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-N-[(2-methoxyphenyl)methyl]oxamide (PubChem CID 121133990) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is N'-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-N-[(2-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-N-[(2-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 121133990 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | N'-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-N-[(2-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccccc1CNC(=O)C(=O)NCc1ccc(C(O)c2ccsc2)s1 |
| InChI | InChI=1S/C20H20N2O4S2/c1-26-16-5-3-2-4-13(16)10-21-19(24)20(25)22-11-15-6-7-17(28-15)18(23)14-8-9-27-12-14/h2-9,12,18,23H,10-11H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | CYUQUYOYLZMUST-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|