C18H17NO2S3 — CID 121133764
N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-2-methylsulfanylbenzamide (PubChem CID 121133764) has the molecular formula C18H17NO2S3 and a molecular weight of 375.54 g/mol. Its IUPAC name is N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 121133764 |
| Molecular Formula | C18H17NO2S3 |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)NCc1ccc(C(O)c2ccsc2)s1 |
| InChI | InChI=1S/C18H17NO2S3/c1-22-15-5-3-2-4-14(15)18(21)19-10-13-6-7-16(24-13)17(20)12-8-9-23-11-12/h2-9,11,17,20H,10H2,1H3,(H,19,21) |
| InChIKey | MRPGLCYJBQYDBP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |