C16H21N3O3S2 — CID 121134021
N-[2-(dimethylamino)ethyl]-N'-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]oxamide (PubChem CID 121134021) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]oxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 121134021 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]oxamide |
| SMILES | CN(C)CCNC(=O)C(=O)NCc1ccc(C(O)c2ccsc2)s1 |
| InChI | InChI=1S/C16H21N3O3S2/c1-19(2)7-6-17-15(21)16(22)18-9-12-3-4-13(24-12)14(20)11-5-8-23-10-11/h3-5,8,10,14,20H,6-7,9H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | OVGIJPUQKHIPHA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|