C14H15NO2S2 — CID 121133703
N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]cyclopropanecarboxamide (PubChem CID 121133703) has the molecular formula C14H15NO2S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 121133703 |
| Molecular Formula | C14H15NO2S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]cyclopropanecarboxamide |
| SMILES | O=C(NCc1ccc(C(O)c2ccsc2)s1)C1CC1 |
| InChI | InChI=1S/C14H15NO2S2/c16-13(10-5-6-18-8-10)12-4-3-11(19-12)7-15-14(17)9-1-2-9/h3-6,8-9,13,16H,1-2,7H2,(H,15,17) |
| InChIKey | NKHWOUNCPYCKOQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |