C22H23NO5S2 — CID 121133837
(E)-N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 121133837) has the molecular formula C22H23NO5S2 and a molecular weight of 445.56 g/mol. Its IUPAC name is (E)-N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 121133837 |
| Molecular Formula | C22H23NO5S2 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (E)-N-[[5-[hydroxy(thiophen-3-yl)methyl]thiophen-2-yl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCc2ccc(C(O)c3ccsc3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C22H23NO5S2/c1-26-17-10-14(11-18(27-2)22(17)28-3)4-7-20(24)23-12-16-5-6-19(30-16)21(25)15-8-9-29-13-15/h4-11,13,21,25H,12H2,1-3H3,(H,23,24)/b7-4+ |
| InChIKey | BODBZMTUSCASCO-QPJJXVBHSA-N |
| XLogP | 4.25 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|