C19H23NO5S — CID 121132169
(E)-N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 121132169) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is (E)-N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 121132169 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (E)-N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCC(O)c2ccsc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H23NO5S/c1-23-16-10-13(11-17(24-2)19(16)25-3)4-5-18(22)20-8-6-15(21)14-7-9-26-12-14/h4-5,7,9-12,15,21H,6,8H2,1-3H3,(H,20,22)/b5-4+ |
| InChIKey | CKFJXXDTBCZSTO-SNAWJCMRSA-N |
| XLogP | 3.03 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|