C25H25NO4 — CID 1186267
(E)-N-benzhydryl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 1186267) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is (E)-N-benzhydryl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-benzhydryl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1186267 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (E)-N-benzhydryl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC(c2ccccc2)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H25NO4/c1-28-21-16-18(17-22(29-2)25(21)30-3)14-15-23(27)26-24(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-17,24H,1-3H3,(H,26,27)/b15-14+ |
| InChIKey | HEZDVPPPMDUKFM-CCEZHUSRSA-N |
| XLogP | 4.63 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|