C30H35NO2 — CID 24843635
(E)-N-benzhydryl-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enamide (PubChem CID 24843635) has the molecular formula C30H35NO2 and a molecular weight of 441.62 g/mol. Its IUPAC name is (E)-N-benzhydryl-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-benzhydryl-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24843635 |
| Molecular Formula | C30H35NO2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | (E)-N-benzhydryl-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enamide |
| SMILES | CC(C)(C)c1cc(/C=C/C(=O)NC(c2ccccc2)c2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H35NO2/c1-29(2,3)24-19-21(20-25(28(24)33)30(4,5)6)17-18-26(32)31-27(22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-20,27,33H,1-6H3,(H,31,32)/b18-17+ |
| InChIKey | VTHRPKHBUHIBJT-ISLYRVAYSA-N |
| XLogP | 6.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|