C22H31NO — CID 139761917
2,6-ditert-butyl-4-[methylamino(phenyl)methyl]phenol (PubChem CID 139761917) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[methylamino(phenyl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[methylamino(phenyl)methyl]phenol |
|---|---|
| PubChem CID | 139761917 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 2,6-ditert-butyl-4-[methylamino(phenyl)methyl]phenol |
| SMILES | CNC(c1ccccc1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H31NO/c1-21(2,3)17-13-16(14-18(20(17)24)22(4,5)6)19(23-7)15-11-9-8-10-12-15/h8-14,19,23-24H,1-7H3 |
| InChIKey | MRQCEEXVGKOYHW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |