C23H31NO2 — CID 139761934
N-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]acetamide (PubChem CID 139761934) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]acetamide.
| Compound Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 139761934 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]acetamide |
| SMILES | CC(=O)NC(c1ccccc1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H31NO2/c1-15(25)24-20(16-11-9-8-10-12-16)17-13-18(22(2,3)4)21(26)19(14-17)23(5,6)7/h8-14,20,26H,1-7H3,(H,24,25) |
| InChIKey | KZNXEGBPTUQLHJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |