About N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide
N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide (PubChem CID 2313610) has the molecular formula C18H29NO2
and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide |
| PubChem CID | 2313610 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H29NO2/c1-11(19-12(2)20)13-9-14(17(3,4)5)16(21)15(10-13)18(6,7)8/h9-11,21H,1-8H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | LFJKGKRIMDUSPC-NSHDSACASA-N |
| XLogP | 4.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide?
The IUPAC name of N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide (CID 2313610) is N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide.
What is the SMILES notation for N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide?
The canonical SMILES for N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide is CC(=O)N[C@@H](C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide?
The InChIKey is LFJKGKRIMDUSPC-NSHDSACASA-N. The full InChI is InChI=1S/C18H29NO2/c1-11(19-12(2)20)13-9-14(17(3,4)5)16(21)15(10-13)18(6,7)8/h9-11,21H,1-8H3,(H,19,20)/t11-/m0/s1.
What are the key properties of N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide?
N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide has a molecular weight of 291.44 g/mol, XLogP of 4.18, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]acetamide is sourced from PubChem (CID 2313610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).