C37H56O4 — CID 175451687
2,6-bis(3,5-ditert-butyl-4-hydroxyphenyl)-4-ethylheptane-3,5-dione (PubChem CID 175451687) has the molecular formula C37H56O4 and a molecular weight of 564.85 g/mol. Its IUPAC name is 2,6-bis(3,5-ditert-butyl-4-hydroxyphenyl)-4-ethylheptane-3,5-dione.
| Compound Name | 2,6-bis(3,5-ditert-butyl-4-hydroxyphenyl)-4-ethylheptane-3,5-dione |
|---|---|
| PubChem CID | 175451687 |
| Molecular Formula | C37H56O4 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.42 |
| IUPAC Name | 2,6-bis(3,5-ditert-butyl-4-hydroxyphenyl)-4-ethylheptane-3,5-dione |
| SMILES | CCC(C(=O)C(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)C(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C37H56O4/c1-16-25(30(38)21(2)23-17-26(34(4,5)6)32(40)27(18-23)35(7,8)9)31(39)22(3)24-19-28(36(10,11)12)33(41)29(20-24)37(13,14)15/h17-22,25,40-41H,16H2,1-15H3 |
| InChIKey | QAGBFYITWXJZSW-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|