C21H34O6 — CID 175593103
2,3,4-trihydroxybutyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 175593103) has the molecular formula C21H34O6 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2,3,4-trihydroxybutyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | 2,3,4-trihydroxybutyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 175593103 |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 2,3,4-trihydroxybutyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C(=O)OCC(O)C(O)CO)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H34O6/c1-12(19(26)27-11-17(24)16(23)10-22)13-8-14(20(2,3)4)18(25)15(9-13)21(5,6)7/h8-9,12,16-17,22-25H,10-11H2,1-7H3 |
| InChIKey | JXHLJVQGKSEJGM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |