C35H56O5S2 — CID 11628737
(2S,3R)-4-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]butane-1,2,3-triol (PubChem CID 11628737) has the molecular formula C35H56O5S2 and a molecular weight of 620.96 g/mol. Its IUPAC name is (2S,3R)-4-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]butane-1,2,3-triol.
| Compound Name | (2S,3R)-4-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]butane-1,2,3-triol |
|---|---|
| PubChem CID | 11628737 |
| Molecular Formula | C35H56O5S2 |
| Molecular Weight | 620.96 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | (2S,3R)-4-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]butane-1,2,3-triol |
| SMILES | CC(C)(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OC[C@@H](O)[C@@H](O)CO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H56O5S2/c1-31(2,3)23-15-21(16-24(29(23)39)32(4,5)6)41-35(13,14)42-22-17-25(33(7,8)9)30(26(18-22)34(10,11)12)40-20-28(38)27(37)19-36/h15-18,27-28,36-39H,19-20H2,1-14H3/t27-,28+/m0/s1 |
| InChIKey | OKYHJQSITLTCSP-WUFINQPMSA-N |
| XLogP | 8.30 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.96 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|