C34H54O4S2 — CID 11456095
3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]propane-1,2-diol (PubChem CID 11456095) has the molecular formula C34H54O4S2 and a molecular weight of 590.94 g/mol. Its IUPAC name is 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 11456095 |
| Molecular Formula | C34H54O4S2 |
| Molecular Weight | 590.94 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]propane-1,2-diol |
| SMILES | CC(C)(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OCC(O)CO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H54O4S2/c1-30(2,3)24-15-22(16-25(28(24)37)31(4,5)6)39-34(13,14)40-23-17-26(32(7,8)9)29(38-20-21(36)19-35)27(18-23)33(10,11)12/h15-18,21,35-37H,19-20H2,1-14H3 |
| InChIKey | IBXYNULIYAUZSE-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.94 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|