C41H61NO2S2 — CID 91339144
2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[2-[4-(dimethylamino)phenyl]ethoxy]phenyl]sulfanylpropan-2-ylsulfanyl]phenol (PubChem CID 91339144) has the molecular formula C41H61NO2S2 and a molecular weight of 664.08 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[2-[4-(dimethylamino)phenyl]ethoxy]phenyl]sulfanylpropan-2-ylsulfanyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[2-[4-(dimethylamino)phenyl]ethoxy]phenyl]sulfanylpropan-2-ylsulfanyl]phenol |
|---|---|
| PubChem CID | 91339144 |
| Molecular Formula | C41H61NO2S2 |
| Molecular Weight | 664.08 g/mol |
| Exact Mass | 663.41 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-[3,5-ditert-butyl-4-[2-[4-(dimethylamino)phenyl]ethoxy]phenyl]sulfanylpropan-2-ylsulfanyl]phenol |
| SMILES | CN(C)c1ccc(CCOc2c(C(C)(C)C)cc(SC(C)(C)Sc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C41H61NO2S2/c1-37(2,3)31-23-29(24-32(35(31)43)38(4,5)6)45-41(13,14)46-30-25-33(39(7,8)9)36(34(26-30)40(10,11)12)44-22-21-27-17-19-28(20-18-27)42(15)16/h17-20,23-26,43H,21-22H2,1-16H3 |
| InChIKey | QGZLWIBZELSTKJ-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.08 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|