C40H66O7S2 — CID 143442674
(2S,3R,4R,5R)-6-[2-tert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]-6-(2-methylhexan-2-yl)phenoxy]hexane-1,2,3,4,5-pentol (PubChem CID 143442674) has the molecular formula C40H66O7S2 and a molecular weight of 723.10 g/mol. Its IUPAC name is (2S,3R,4R,5R)-6-[2-tert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]-6-(2-methylhexan-2-yl)phenoxy]hexane-1,2,3,4,5-pentol.
| Compound Name | (2S,3R,4R,5R)-6-[2-tert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]-6-(2-methylhexan-2-yl)phenoxy]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 143442674 |
| Molecular Formula | C40H66O7S2 |
| Molecular Weight | 723.10 g/mol |
| Exact Mass | 722.42 |
| IUPAC Name | (2S,3R,4R,5R)-6-[2-tert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]-6-(2-methylhexan-2-yl)phenoxy]hexane-1,2,3,4,5-pentol |
| SMILES | CCCCC(C)(C)c1cc(SC(C)(C)Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C40H66O7S2/c1-15-16-17-39(11,12)29-21-25(20-28(38(8,9)10)35(29)47-23-31(43)34(46)33(45)30(42)22-41)49-40(13,14)48-24-18-26(36(2,3)4)32(44)27(19-24)37(5,6)7/h18-21,30-31,33-34,41-46H,15-17,22-23H2,1-14H3/t30-,31+,33+,34+/m0/s1 |
| InChIKey | ROIOUBKSWHHMDW-WVBWOMQXSA-N |
| XLogP | 8.19 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.10 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|