C34H52O4S2 — CID 11273322
3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]propanoic acid (PubChem CID 11273322) has the molecular formula C34H52O4S2 and a molecular weight of 588.92 g/mol. Its IUPAC name is 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]propanoic acid.
| Compound Name | 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 11273322 |
| Molecular Formula | C34H52O4S2 |
| Molecular Weight | 588.92 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]propanoic acid |
| SMILES | CC(C)(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H52O4S2/c1-30(2,3)23-17-21(18-24(28(23)37)31(4,5)6)39-34(13,14)40-22-19-25(32(7,8)9)29(38-16-15-27(35)36)26(20-22)33(10,11)12/h17-20,37H,15-16H2,1-14H3,(H,35,36) |
| InChIKey | MWLVIHDMPSXSIR-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.92 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|