C21H34O3S — CID 14796229
7-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylheptanoic acid (PubChem CID 14796229) has the molecular formula C21H34O3S and a molecular weight of 366.57 g/mol. Its IUPAC name is 7-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylheptanoic acid.
| Compound Name | 7-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylheptanoic acid |
|---|---|
| PubChem CID | 14796229 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 7-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylheptanoic acid |
| SMILES | CC(C)(C)c1cc(SCCCCCCC(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H34O3S/c1-20(2,3)16-13-15(14-17(19(16)24)21(4,5)6)25-12-10-8-7-9-11-18(22)23/h13-14,24H,7-12H2,1-6H3,(H,22,23) |
| InChIKey | NXSJDIOIYNJRRG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|