C26H37NO3S — CID 15035271
N-benzyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-N-hydroxypentanamide (PubChem CID 15035271) has the molecular formula C26H37NO3S and a molecular weight of 443.65 g/mol. Its IUPAC name is N-benzyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-N-hydroxypentanamide.
| Compound Name | N-benzyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-N-hydroxypentanamide |
|---|---|
| PubChem CID | 15035271 |
| Molecular Formula | C26H37NO3S |
| Molecular Weight | 443.65 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-benzyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-N-hydroxypentanamide |
| SMILES | CC(C)(C)c1cc(SCCCCC(=O)N(O)Cc2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H37NO3S/c1-25(2,3)21-16-20(17-22(24(21)29)26(4,5)6)31-15-11-10-14-23(28)27(30)18-19-12-8-7-9-13-19/h7-9,12-13,16-17,29-30H,10-11,14-15,18H2,1-6H3 |
| InChIKey | LSESMCVDPHTFFJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|