C42H44N2O3S — CID 159675633
S-(3,5-ditert-butyl-4-hydroxyphenyl) 3-(N-[4-(4-benzylanilino)phenyl]anilino)-3-oxopropanethioate (PubChem CID 159675633) has the molecular formula C42H44N2O3S and a molecular weight of 656.89 g/mol. Its IUPAC name is S-(3,5-ditert-butyl-4-hydroxyphenyl) 3-(N-[4-(4-benzylanilino)phenyl]anilino)-3-oxopropanethioate.
| Compound Name | S-(3,5-ditert-butyl-4-hydroxyphenyl) 3-(N-[4-(4-benzylanilino)phenyl]anilino)-3-oxopropanethioate |
|---|---|
| PubChem CID | 159675633 |
| Molecular Formula | C42H44N2O3S |
| Molecular Weight | 656.89 g/mol |
| Exact Mass | 656.31 |
| IUPAC Name | S-(3,5-ditert-butyl-4-hydroxyphenyl) 3-(N-[4-(4-benzylanilino)phenyl]anilino)-3-oxopropanethioate |
| SMILES | CC(C)(C)c1cc(SC(=O)CC(=O)N(c2ccccc2)c2ccc(Nc3ccc(Cc4ccccc4)cc3)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C42H44N2O3S/c1-41(2,3)36-26-35(27-37(40(36)47)42(4,5)6)48-39(46)28-38(45)44(33-15-11-8-12-16-33)34-23-21-32(22-24-34)43-31-19-17-30(18-20-31)25-29-13-9-7-10-14-29/h7-24,26-27,43,47H,25,28H2,1-6H3 |
| InChIKey | XUDZKIJZEVLRES-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.89 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|