C48H59NO — CID 58031325
4-[[4-[[4-[(4-benzylphenyl)methyl]phenyl]methyl]-N-(4-methylpentan-2-yl)anilino]methyl]-2,6-ditert-butylphenol (PubChem CID 58031325) has the molecular formula C48H59NO and a molecular weight of 666.01 g/mol. Its IUPAC name is 4-[[4-[[4-[(4-benzylphenyl)methyl]phenyl]methyl]-N-(4-methylpentan-2-yl)anilino]methyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[[4-[[4-[(4-benzylphenyl)methyl]phenyl]methyl]-N-(4-methylpentan-2-yl)anilino]methyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 58031325 |
| Molecular Formula | C48H59NO |
| Molecular Weight | 666.01 g/mol |
| Exact Mass | 665.46 |
| IUPAC Name | 4-[[4-[[4-[(4-benzylphenyl)methyl]phenyl]methyl]-N-(4-methylpentan-2-yl)anilino]methyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)CC(C)N(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1ccc(Cc2ccc(Cc3ccc(Cc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H59NO/c1-34(2)27-35(3)49(33-42-31-44(47(4,5)6)46(50)45(32-42)48(7,8)9)43-25-23-41(24-26-43)30-40-21-19-39(20-22-40)29-38-17-15-37(16-18-38)28-36-13-11-10-12-14-36/h10-26,31-32,34-35,50H,27-30,33H2,1-9H3 |
| InChIKey | BTUIKUKLNMGALT-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.01 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|