C39H51N3O — CID 59265249
2-[[4-(4-anilinoanilino)-N-(4-methylpentan-2-yl)anilino]methyl]-4,6-ditert-butylphenol (PubChem CID 59265249) has the molecular formula C39H51N3O and a molecular weight of 577.86 g/mol. Its IUPAC name is 2-[[4-(4-anilinoanilino)-N-(4-methylpentan-2-yl)anilino]methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[[4-(4-anilinoanilino)-N-(4-methylpentan-2-yl)anilino]methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 59265249 |
| Molecular Formula | C39H51N3O |
| Molecular Weight | 577.86 g/mol |
| Exact Mass | 577.40 |
| IUPAC Name | 2-[[4-(4-anilinoanilino)-N-(4-methylpentan-2-yl)anilino]methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)CC(C)N(Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O)c1ccc(Nc2ccc(Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C39H51N3O/c1-27(2)23-28(3)42(26-29-24-30(38(4,5)6)25-36(37(29)43)39(7,8)9)35-21-19-34(20-22-35)41-33-17-15-32(16-18-33)40-31-13-11-10-12-14-31/h10-22,24-25,27-28,40-41,43H,23,26H2,1-9H3 |
| InChIKey | BNIWWNBSIZGHIE-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.86 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|