C31H41NO — CID 58150834
2-[[4-benzyl-N-(4-methylpentan-2-yl)anilino]methyl]-6-tert-butyl-4-methylphenol (PubChem CID 58150834) has the molecular formula C31H41NO and a molecular weight of 443.68 g/mol. Its IUPAC name is 2-[[4-benzyl-N-(4-methylpentan-2-yl)anilino]methyl]-6-tert-butyl-4-methylphenol.
| Compound Name | 2-[[4-benzyl-N-(4-methylpentan-2-yl)anilino]methyl]-6-tert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 58150834 |
| Molecular Formula | C31H41NO |
| Molecular Weight | 443.68 g/mol |
| Exact Mass | 443.32 |
| IUPAC Name | 2-[[4-benzyl-N-(4-methylpentan-2-yl)anilino]methyl]-6-tert-butyl-4-methylphenol |
| SMILES | Cc1cc(CN(c2ccc(Cc3ccccc3)cc2)C(C)CC(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H41NO/c1-22(2)17-24(4)32(21-27-18-23(3)19-29(30(27)33)31(5,6)7)28-15-13-26(14-16-28)20-25-11-9-8-10-12-25/h8-16,18-19,22,24,33H,17,20-21H2,1-7H3 |
| InChIKey | ZZAOZZUGVNCSFU-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.68 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|