C42H63NO — CID 58031338
2,4-ditert-butyl-6-[[N-(4-methylpentan-2-yl)-4-[[4-(2,4,4-trimethylpentyl)phenyl]methyl]anilino]methyl]phenol (PubChem CID 58031338) has the molecular formula C42H63NO and a molecular weight of 597.97 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[N-(4-methylpentan-2-yl)-4-[[4-(2,4,4-trimethylpentyl)phenyl]methyl]anilino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[N-(4-methylpentan-2-yl)-4-[[4-(2,4,4-trimethylpentyl)phenyl]methyl]anilino]methyl]phenol |
|---|---|
| PubChem CID | 58031338 |
| Molecular Formula | C42H63NO |
| Molecular Weight | 597.97 g/mol |
| Exact Mass | 597.49 |
| IUPAC Name | 2,4-ditert-butyl-6-[[N-(4-methylpentan-2-yl)-4-[[4-(2,4,4-trimethylpentyl)phenyl]methyl]anilino]methyl]phenol |
| SMILES | CC(C)CC(C)N(Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O)c1ccc(Cc2ccc(CC(C)CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C42H63NO/c1-29(2)22-31(4)43(28-35-25-36(41(8,9)10)26-38(39(35)44)42(11,12)13)37-20-18-34(19-21-37)24-33-16-14-32(15-17-33)23-30(3)27-40(5,6)7/h14-21,25-26,29-31,44H,22-24,27-28H2,1-13H3 |
| InChIKey | ZFDHSVYEBCDNMY-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.97 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|