C47H60N4O — CID 88975405
2,4-ditert-butyl-6-[[4-[4-[4-[4-(2,4,4-trimethylpentyl)anilino]anilino]anilino]anilino]methyl]phenol (PubChem CID 88975405) has the molecular formula C47H60N4O and a molecular weight of 697.02 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[4-[4-[4-[4-(2,4,4-trimethylpentyl)anilino]anilino]anilino]anilino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[4-[4-[4-[4-(2,4,4-trimethylpentyl)anilino]anilino]anilino]anilino]methyl]phenol |
|---|---|
| PubChem CID | 88975405 |
| Molecular Formula | C47H60N4O |
| Molecular Weight | 697.02 g/mol |
| Exact Mass | 696.48 |
| IUPAC Name | 2,4-ditert-butyl-6-[[4-[4-[4-[4-(2,4,4-trimethylpentyl)anilino]anilino]anilino]anilino]methyl]phenol |
| SMILES | CC(Cc1ccc(Nc2ccc(Nc3ccc(Nc4ccc(NCc5cc(C(C)(C)C)cc(C(C)(C)C)c5O)cc4)cc3)cc2)cc1)CC(C)(C)C |
| InChI | InChI=1S/C47H60N4O/c1-32(30-45(2,3)4)27-33-11-13-37(14-12-33)49-39-19-21-41(22-20-39)51-42-25-23-40(24-26-42)50-38-17-15-36(16-18-38)48-31-34-28-35(46(5,6)7)29-43(44(34)52)47(8,9)10/h11-26,28-29,32,48-52H,27,30-31H2,1-10H3 |
| InChIKey | WHBXUAHJWUUGLB-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 68.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.02 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|