C22H31NO2 — CID 101388446
2,4-ditert-butyl-6-[(2-hydroxy-5-methylanilino)methyl]phenol (PubChem CID 101388446) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(2-hydroxy-5-methylanilino)methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(2-hydroxy-5-methylanilino)methyl]phenol |
|---|---|
| PubChem CID | 101388446 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 2,4-ditert-butyl-6-[(2-hydroxy-5-methylanilino)methyl]phenol |
| SMILES | Cc1ccc(O)c(NCc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c1 |
| InChI | InChI=1S/C22H31NO2/c1-14-8-9-19(24)18(10-14)23-13-15-11-16(21(2,3)4)12-17(20(15)25)22(5,6)7/h8-12,23-25H,13H2,1-7H3 |
| InChIKey | BKWDMUUOGULHGN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|